C33H40N4O3 — CID 16993131
2-[2-[5-[[2-(2,5-dimethylphenoxy)acetyl]amino]pentyl]benzimidazol-1-yl]-N-phenyl-N-propan-2-ylacetamide (PubChem CID 16993131) has the molecular formula C33H40N4O3 and a molecular weight of 540.71 g/mol. Its IUPAC name is 2-[2-[5-[[2-(2,5-dimethylphenoxy)acetyl]amino]pentyl]benzimidazol-1-yl]-N-phenyl-N-propan-2-ylacetamide.
| Compound Name | 2-[2-[5-[[2-(2,5-dimethylphenoxy)acetyl]amino]pentyl]benzimidazol-1-yl]-N-phenyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 16993131 |
| Molecular Formula | C33H40N4O3 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 2-[2-[5-[[2-(2,5-dimethylphenoxy)acetyl]amino]pentyl]benzimidazol-1-yl]-N-phenyl-N-propan-2-ylacetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)NCCCCCc2nc3ccccc3n2CC(=O)N(c2ccccc2)C(C)C)c1 |
| InChI | InChI=1S/C33H40N4O3/c1-24(2)37(27-13-7-5-8-14-27)33(39)22-36-29-16-11-10-15-28(29)35-31(36)17-9-6-12-20-34-32(38)23-40-30-21-25(3)18-19-26(30)4/h5,7-8,10-11,13-16,18-19,21,24H,6,9,12,17,20,22-23H2,1-4H3,(H,34,38) |
| InChIKey | UDHKCEUZZKCWKW-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|