C29H33N3O4 — CID 16978697
2-(2,5-dimethylphenoxy)-N-[2-[1-[3-(4-methoxyphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide (PubChem CID 16978697) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[2-[1-[3-(4-methoxyphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[2-[1-[3-(4-methoxyphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16978697 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[2-[1-[3-(4-methoxyphenoxy)propyl]benzimidazol-2-yl]ethyl]acetamide |
| SMILES | COc1ccc(OCCCn2c(CCNC(=O)COc3cc(C)ccc3C)nc3ccccc32)cc1 |
| InChI | InChI=1S/C29H33N3O4/c1-21-9-10-22(2)27(19-21)36-20-29(33)30-16-15-28-31-25-7-4-5-8-26(25)32(28)17-6-18-35-24-13-11-23(34-3)12-14-24/h4-5,7-14,19H,6,15-18,20H2,1-3H3,(H,30,33) |
| InChIKey | OAEDXVAHMLVONI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|