C30H35N3O3 — CID 16971352
2-(2,5-dimethylphenoxy)-N-[[1-[4-(4-ethylphenoxy)butyl]benzimidazol-2-yl]methyl]acetamide (PubChem CID 16971352) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[[1-[4-(4-ethylphenoxy)butyl]benzimidazol-2-yl]methyl]acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[[1-[4-(4-ethylphenoxy)butyl]benzimidazol-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 16971352 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[[1-[4-(4-ethylphenoxy)butyl]benzimidazol-2-yl]methyl]acetamide |
| SMILES | CCc1ccc(OCCCCn2c(CNC(=O)COc3cc(C)ccc3C)nc3ccccc32)cc1 |
| InChI | InChI=1S/C30H35N3O3/c1-4-24-13-15-25(16-14-24)35-18-8-7-17-33-27-10-6-5-9-26(27)32-29(33)20-31-30(34)21-36-28-19-22(2)11-12-23(28)3/h5-6,9-16,19H,4,7-8,17-18,20-21H2,1-3H3,(H,31,34) |
| InChIKey | MTRLJWOXBJNDNT-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|