C23H29N3O2 — CID 16974430
N-[2-[1-[2-(2,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]ethyl]butanamide (PubChem CID 16974430) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is N-[2-[1-[2-(2,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]ethyl]butanamide.
| Compound Name | N-[2-[1-[2-(2,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]ethyl]butanamide |
|---|---|
| PubChem CID | 16974430 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-[2-[1-[2-(2,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]ethyl]butanamide |
| SMILES | CCCC(=O)NCCc1nc2ccccc2n1CCOc1cc(C)ccc1C |
| InChI | InChI=1S/C23H29N3O2/c1-4-7-23(27)24-13-12-22-25-19-8-5-6-9-20(19)26(22)14-15-28-21-16-17(2)10-11-18(21)3/h5-6,8-11,16H,4,7,12-15H2,1-3H3,(H,24,27) |
| InChIKey | DDWZFDVHLKJBDU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |