C25H33N3O2 — CID 16981444
N-[3-[1-[2-(2,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]propyl]-2,2-dimethylpropanamide (PubChem CID 16981444) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[3-[1-[2-(2,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]propyl]-2,2-dimethylpropanamide.
| Compound Name | N-[3-[1-[2-(2,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]propyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 16981444 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-[3-[1-[2-(2,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]propyl]-2,2-dimethylpropanamide |
| SMILES | Cc1ccc(C)c(OCCn2c(CCCNC(=O)C(C)(C)C)nc3ccccc32)c1 |
| InChI | InChI=1S/C25H33N3O2/c1-18-12-13-19(2)22(17-18)30-16-15-28-21-10-7-6-9-20(21)27-23(28)11-8-14-26-24(29)25(3,4)5/h6-7,9-10,12-13,17H,8,11,14-16H2,1-5H3,(H,26,29) |
| InChIKey | UFPSEBWFCFWDER-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|