C26H33N3O2 — CID 16992075
(E)-N-[5-[1-[2-(2,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]but-2-enamide (PubChem CID 16992075) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is (E)-N-[5-[1-[2-(2,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]but-2-enamide.
| Compound Name | (E)-N-[5-[1-[2-(2,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]but-2-enamide |
|---|---|
| PubChem CID | 16992075 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | (E)-N-[5-[1-[2-(2,5-dimethylphenoxy)ethyl]benzimidazol-2-yl]pentyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NCCCCCc1nc2ccccc2n1CCOc1cc(C)ccc1C |
| InChI | InChI=1S/C26H33N3O2/c1-4-10-26(30)27-16-9-5-6-13-25-28-22-11-7-8-12-23(22)29(25)17-18-31-24-19-20(2)14-15-21(24)3/h4,7-8,10-12,14-15,19H,5-6,9,13,16-18H2,1-3H3,(H,27,30)/b10-4+ |
| InChIKey | IGSGZALDAQURLZ-ONNFQVAWSA-N |
| XLogP | 5.14 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|