C31H36ClN3O3 — CID 16978870
2-(4-chlorophenoxy)-N-[2-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide (PubChem CID 16978870) has the molecular formula C31H36ClN3O3 and a molecular weight of 534.10 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[2-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[2-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16978870 |
| Molecular Formula | C31H36ClN3O3 |
| Molecular Weight | 534.10 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[2-[1-[4-(5-methyl-2-propan-2-ylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide |
| SMILES | Cc1ccc(C(C)C)c(OCCCCn2c(CCNC(=O)COc3ccc(Cl)cc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C31H36ClN3O3/c1-22(2)26-15-10-23(3)20-29(26)37-19-7-6-18-35-28-9-5-4-8-27(28)34-30(35)16-17-33-31(36)21-38-25-13-11-24(32)12-14-25/h4-5,8-15,20,22H,6-7,16-19,21H2,1-3H3,(H,33,36) |
| InChIKey | SGZZWOOWGZZPGN-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.10 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|