C24H21Cl2N3O2 — CID 17007500
2-chloro-N-[[1-[3-(4-chlorophenoxy)propyl]benzimidazol-2-yl]methyl]benzamide (PubChem CID 17007500) has the molecular formula C24H21Cl2N3O2 and a molecular weight of 454.36 g/mol. Its IUPAC name is 2-chloro-N-[[1-[3-(4-chlorophenoxy)propyl]benzimidazol-2-yl]methyl]benzamide.
| Compound Name | 2-chloro-N-[[1-[3-(4-chlorophenoxy)propyl]benzimidazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 17007500 |
| Molecular Formula | C24H21Cl2N3O2 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 2-chloro-N-[[1-[3-(4-chlorophenoxy)propyl]benzimidazol-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1nc2ccccc2n1CCCOc1ccc(Cl)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C24H21Cl2N3O2/c25-17-10-12-18(13-11-17)31-15-5-14-29-22-9-4-3-8-21(22)28-23(29)16-27-24(30)19-6-1-2-7-20(19)26/h1-4,6-13H,5,14-16H2,(H,27,30) |
| InChIKey | YUKTUFKPEWFLFV-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|