C23H25N3O3 — CID 16970414
propan-2-yl 2-[2-[1-[[(Z)-3-phenylprop-2-enoyl]amino]ethyl]benzimidazol-1-yl]acetate (PubChem CID 16970414) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is propan-2-yl 2-[2-[1-[[(Z)-3-phenylprop-2-enoyl]amino]ethyl]benzimidazol-1-yl]acetate.
| Compound Name | propan-2-yl 2-[2-[1-[[(Z)-3-phenylprop-2-enoyl]amino]ethyl]benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 16970414 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | propan-2-yl 2-[2-[1-[[(Z)-3-phenylprop-2-enoyl]amino]ethyl]benzimidazol-1-yl]acetate |
| SMILES | CC(C)OC(=O)Cn1c(C(C)NC(=O)/C=C\c2ccccc2)nc2ccccc21 |
| InChI | InChI=1S/C23H25N3O3/c1-16(2)29-22(28)15-26-20-12-8-7-11-19(20)25-23(26)17(3)24-21(27)14-13-18-9-5-4-6-10-18/h4-14,16-17H,15H2,1-3H3,(H,24,27)/b14-13- |
| InChIKey | VYENUHXTNRDFMF-YPKPFQOOSA-N |
| XLogP | 3.88 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|