C29H31N3O2 — CID 16970339
(Z)-N-[1-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide (PubChem CID 16970339) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is (Z)-N-[1-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[1-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16970339 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | (Z)-N-[1-[1-[3-(2,3-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-3-phenylprop-2-enamide |
| SMILES | Cc1cccc(OCCCn2c(C(C)NC(=O)/C=C\c3ccccc3)nc3ccccc32)c1C |
| InChI | InChI=1S/C29H31N3O2/c1-21-11-9-16-27(22(21)2)34-20-10-19-32-26-15-8-7-14-25(26)31-29(32)23(3)30-28(33)18-17-24-12-5-4-6-13-24/h4-9,11-18,23H,10,19-20H2,1-3H3,(H,30,33)/b18-17- |
| InChIKey | CGPSDZASNZTGMG-ZCXUNETKSA-N |
| XLogP | 6.01 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|