C31H37N3O3 — CID 16972135
2-(2,5-dimethylphenoxy)-N-[1-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide (PubChem CID 16972135) has the molecular formula C31H37N3O3 and a molecular weight of 499.66 g/mol. Its IUPAC name is 2-(2,5-dimethylphenoxy)-N-[1-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide.
| Compound Name | 2-(2,5-dimethylphenoxy)-N-[1-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 16972135 |
| Molecular Formula | C31H37N3O3 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | 2-(2,5-dimethylphenoxy)-N-[1-[1-[4-(2,3-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]acetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)NC(C)c2nc3ccccc3n2CCCCOc2cccc(C)c2C)c1 |
| InChI | InChI=1S/C31H37N3O3/c1-21-15-16-23(3)29(19-21)37-20-30(35)32-25(5)31-33-26-12-6-7-13-27(26)34(31)17-8-9-18-36-28-14-10-11-22(2)24(28)4/h6-7,10-16,19,25H,8-9,17-18,20H2,1-5H3,(H,32,35) |
| InChIKey | CPWVTCWDWXSMEA-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|