C25H31N3O2 — CID 16969723
N-[1-[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]cyclopropanecarboxamide (PubChem CID 16969723) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[1-[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[1-[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 16969723 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | N-[1-[1-[4-(2,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]cyclopropanecarboxamide |
| SMILES | Cc1ccc(C)c(OCCCCn2c(C(C)NC(=O)C3CC3)nc3ccccc32)c1 |
| InChI | InChI=1S/C25H31N3O2/c1-17-10-11-18(2)23(16-17)30-15-7-6-14-28-22-9-5-4-8-21(22)27-24(28)19(3)26-25(29)20-12-13-20/h4-5,8-11,16,19-20H,6-7,12-15H2,1-3H3,(H,26,29) |
| InChIKey | WZQIOOSJXKUZJI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|