C25H27N3O3 — CID 42100830
N-[(1S)-1-[1-[3-(2,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide (PubChem CID 42100830) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[(1S)-1-[1-[3-(2,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-[(1S)-1-[1-[3-(2,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42100830 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | N-[(1S)-1-[1-[3-(2,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide |
| SMILES | Cc1ccc(C)c(OCCCn2c([C@H](C)NC(=O)c3ccco3)nc3ccccc32)c1 |
| InChI | InChI=1S/C25H27N3O3/c1-17-11-12-18(2)23(16-17)31-15-7-13-28-21-9-5-4-8-20(21)27-24(28)19(3)26-25(29)22-10-6-14-30-22/h4-6,8-12,14,16,19H,7,13,15H2,1-3H3,(H,26,29)/t19-/m0/s1 |
| InChIKey | FZNAADKKCCTLCT-IBGZPJMESA-N |
| XLogP | 5.21 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|