C26H28ClN3O3 — CID 16973574
N-[1-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide (PubChem CID 16973574) has the molecular formula C26H28ClN3O3 and a molecular weight of 465.98 g/mol. Its IUPAC name is N-[1-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide.
| Compound Name | N-[1-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 16973574 |
| Molecular Formula | C26H28ClN3O3 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-[1-[1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]furan-2-carboxamide |
| SMILES | Cc1cc(OCCCCn2c(C(C)NC(=O)c3ccco3)nc3ccccc32)cc(C)c1Cl |
| InChI | InChI=1S/C26H28ClN3O3/c1-17-15-20(16-18(2)24(17)27)32-13-7-6-12-30-22-10-5-4-9-21(22)29-25(30)19(3)28-26(31)23-11-8-14-33-23/h4-5,8-11,14-16,19H,6-7,12-13H2,1-3H3,(H,28,31) |
| InChIKey | LVLDQHCNRPCXHS-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|