C28H30ClN3O2 — CID 16972593
N-[1-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-phenylacetamide (PubChem CID 16972593) has the molecular formula C28H30ClN3O2 and a molecular weight of 476.02 g/mol. Its IUPAC name is N-[1-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-phenylacetamide.
| Compound Name | N-[1-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 16972593 |
| Molecular Formula | C28H30ClN3O2 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | N-[1-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-phenylacetamide |
| SMILES | Cc1cc(OCCCn2c(C(C)NC(=O)Cc3ccccc3)nc3ccccc32)cc(C)c1Cl |
| InChI | InChI=1S/C28H30ClN3O2/c1-19-16-23(17-20(2)27(19)29)34-15-9-14-32-25-13-8-7-12-24(25)31-28(32)21(3)30-26(33)18-22-10-5-4-6-11-22/h4-8,10-13,16-17,21H,9,14-15,18H2,1-3H3,(H,30,33) |
| InChIKey | PINUIQMLUBMCAS-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|