C27H28ClN3O2 — CID 16972594
N-[1-[1-[3-(4-chloro-3-methylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-phenylacetamide (PubChem CID 16972594) has the molecular formula C27H28ClN3O2 and a molecular weight of 461.99 g/mol. Its IUPAC name is N-[1-[1-[3-(4-chloro-3-methylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-phenylacetamide.
| Compound Name | N-[1-[1-[3-(4-chloro-3-methylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 16972594 |
| Molecular Formula | C27H28ClN3O2 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | N-[1-[1-[3-(4-chloro-3-methylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-phenylacetamide |
| SMILES | Cc1cc(OCCCn2c(C(C)NC(=O)Cc3ccccc3)nc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C27H28ClN3O2/c1-19-17-22(13-14-23(19)28)33-16-8-15-31-25-12-7-6-11-24(25)30-27(31)20(2)29-26(32)18-21-9-4-3-5-10-21/h3-7,9-14,17,20H,8,15-16,18H2,1-2H3,(H,29,32) |
| InChIKey | BMWIFANRWRNQFI-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|