C25H33N3O — CID 18885088
1-[4-(2,5-dimethylphenoxy)butyl]-2-(1-pyrrolidin-1-ylethyl)benzimidazole (PubChem CID 18885088) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-[4-(2,5-dimethylphenoxy)butyl]-2-(1-pyrrolidin-1-ylethyl)benzimidazole.
| Compound Name | 1-[4-(2,5-dimethylphenoxy)butyl]-2-(1-pyrrolidin-1-ylethyl)benzimidazole |
|---|---|
| PubChem CID | 18885088 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 1-[4-(2,5-dimethylphenoxy)butyl]-2-(1-pyrrolidin-1-ylethyl)benzimidazole |
| SMILES | Cc1ccc(C)c(OCCCCn2c(C(C)N3CCCC3)nc3ccccc32)c1 |
| InChI | InChI=1S/C25H33N3O/c1-19-12-13-20(2)24(18-19)29-17-9-8-16-28-23-11-5-4-10-22(23)26-25(28)21(3)27-14-6-7-15-27/h4-5,10-13,18,21H,6-9,14-17H2,1-3H3 |
| InChIKey | DJDMABPLTDZRQG-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|