C24H31N3O2 — CID 18885098
1-[4-(4-methoxyphenoxy)butyl]-2-(1-pyrrolidin-1-ylethyl)benzimidazole (PubChem CID 18885098) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is 1-[4-(4-methoxyphenoxy)butyl]-2-(1-pyrrolidin-1-ylethyl)benzimidazole.
| Compound Name | 1-[4-(4-methoxyphenoxy)butyl]-2-(1-pyrrolidin-1-ylethyl)benzimidazole |
|---|---|
| PubChem CID | 18885098 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 1-[4-(4-methoxyphenoxy)butyl]-2-(1-pyrrolidin-1-ylethyl)benzimidazole |
| SMILES | COc1ccc(OCCCCn2c(C(C)N3CCCC3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C24H31N3O2/c1-19(26-15-5-6-16-26)24-25-22-9-3-4-10-23(22)27(24)17-7-8-18-29-21-13-11-20(28-2)12-14-21/h3-4,9-14,19H,5-8,15-18H2,1-2H3 |
| InChIKey | PTBBAEDQDQKJGY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|