C17H25N3 — CID 92735667
1-butyl-2-[(1S)-1-pyrrolidin-1-ylethyl]benzimidazole (PubChem CID 92735667) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 1-butyl-2-[(1S)-1-pyrrolidin-1-ylethyl]benzimidazole.
| Compound Name | 1-butyl-2-[(1S)-1-pyrrolidin-1-ylethyl]benzimidazole |
|---|---|
| PubChem CID | 92735667 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 1-butyl-2-[(1S)-1-pyrrolidin-1-ylethyl]benzimidazole |
| SMILES | CCCCn1c([C@H](C)N2CCCC2)nc2ccccc21 |
| InChI | InChI=1S/C17H25N3/c1-3-4-13-20-16-10-6-5-9-15(16)18-17(20)14(2)19-11-7-8-12-19/h5-6,9-10,14H,3-4,7-8,11-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | NSCOTBOOBOWWRH-AWEZNQCLSA-N |
| XLogP | 3.99 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |