C26H36N4O — CID 18885216
1-[4-(2,3-dimethylphenoxy)butyl]-2-[1-(4-methylpiperazin-1-yl)ethyl]benzimidazole (PubChem CID 18885216) has the molecular formula C26H36N4O and a molecular weight of 420.60 g/mol. Its IUPAC name is 1-[4-(2,3-dimethylphenoxy)butyl]-2-[1-(4-methylpiperazin-1-yl)ethyl]benzimidazole.
| Compound Name | 1-[4-(2,3-dimethylphenoxy)butyl]-2-[1-(4-methylpiperazin-1-yl)ethyl]benzimidazole |
|---|---|
| PubChem CID | 18885216 |
| Molecular Formula | C26H36N4O |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 1-[4-(2,3-dimethylphenoxy)butyl]-2-[1-(4-methylpiperazin-1-yl)ethyl]benzimidazole |
| SMILES | Cc1cccc(OCCCCn2c(C(C)N3CCN(C)CC3)nc3ccccc32)c1C |
| InChI | InChI=1S/C26H36N4O/c1-20-10-9-13-25(21(20)2)31-19-8-7-14-30-24-12-6-5-11-23(24)27-26(30)22(3)29-17-15-28(4)16-18-29/h5-6,9-13,22H,7-8,14-19H2,1-4H3 |
| InChIKey | UHODAROOLYGFKU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|