C26H27ClN2O2 — CID 16998981
2-[1-(4-chlorophenoxy)ethyl]-1-[3-(2,3-dimethylphenoxy)propyl]benzimidazole (PubChem CID 16998981) has the molecular formula C26H27ClN2O2 and a molecular weight of 434.97 g/mol. Its IUPAC name is 2-[1-(4-chlorophenoxy)ethyl]-1-[3-(2,3-dimethylphenoxy)propyl]benzimidazole.
| Compound Name | 2-[1-(4-chlorophenoxy)ethyl]-1-[3-(2,3-dimethylphenoxy)propyl]benzimidazole |
|---|---|
| PubChem CID | 16998981 |
| Molecular Formula | C26H27ClN2O2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-[1-(4-chlorophenoxy)ethyl]-1-[3-(2,3-dimethylphenoxy)propyl]benzimidazole |
| SMILES | Cc1cccc(OCCCn2c(C(C)Oc3ccc(Cl)cc3)nc3ccccc32)c1C |
| InChI | InChI=1S/C26H27ClN2O2/c1-18-8-6-11-25(19(18)2)30-17-7-16-29-24-10-5-4-9-23(24)28-26(29)20(3)31-22-14-12-21(27)13-15-22/h4-6,8-15,20H,7,16-17H2,1-3H3 |
| InChIKey | ZPJHWRIGFYRTLO-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|