C24H31N3O3 — CID 16969258
N-[1-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-2-methoxyacetamide (PubChem CID 16969258) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is N-[1-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-2-methoxyacetamide.
| Compound Name | N-[1-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 16969258 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | N-[1-[1-[4-(2,4-dimethylphenoxy)butyl]benzimidazol-2-yl]ethyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NC(C)c1nc2ccccc2n1CCCCOc1ccc(C)cc1C |
| InChI | InChI=1S/C24H31N3O3/c1-17-11-12-22(18(2)15-17)30-14-8-7-13-27-21-10-6-5-9-20(21)26-24(27)19(3)25-23(28)16-29-4/h5-6,9-12,15,19H,7-8,13-14,16H2,1-4H3,(H,25,28) |
| InChIKey | ACHUVLXIWSITOA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|