C32H39N3O3 — CID 16972127
N-[1-[1-[3-(4-tert-butylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-(2,5-dimethylphenoxy)acetamide (PubChem CID 16972127) has the molecular formula C32H39N3O3 and a molecular weight of 513.68 g/mol. Its IUPAC name is N-[1-[1-[3-(4-tert-butylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-(2,5-dimethylphenoxy)acetamide.
| Compound Name | N-[1-[1-[3-(4-tert-butylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-(2,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 16972127 |
| Molecular Formula | C32H39N3O3 |
| Molecular Weight | 513.68 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | N-[1-[1-[3-(4-tert-butylphenoxy)propyl]benzimidazol-2-yl]ethyl]-2-(2,5-dimethylphenoxy)acetamide |
| SMILES | Cc1ccc(C)c(OCC(=O)NC(C)c2nc3ccccc3n2CCCOc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C32H39N3O3/c1-22-12-13-23(2)29(20-22)38-21-30(36)33-24(3)31-34-27-10-7-8-11-28(27)35(31)18-9-19-37-26-16-14-25(15-17-26)32(4,5)6/h7-8,10-17,20,24H,9,18-19,21H2,1-6H3,(H,33,36) |
| InChIKey | VRWYZXXVEOCZSS-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.68 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|