C30H36N2O2 — CID 16998033
1-[4-(4-tert-butylphenoxy)butyl]-2-[(2,5-dimethylphenoxy)methyl]benzimidazole (PubChem CID 16998033) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is 1-[4-(4-tert-butylphenoxy)butyl]-2-[(2,5-dimethylphenoxy)methyl]benzimidazole.
| Compound Name | 1-[4-(4-tert-butylphenoxy)butyl]-2-[(2,5-dimethylphenoxy)methyl]benzimidazole |
|---|---|
| PubChem CID | 16998033 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 1-[4-(4-tert-butylphenoxy)butyl]-2-[(2,5-dimethylphenoxy)methyl]benzimidazole |
| SMILES | Cc1ccc(C)c(OCc2nc3ccccc3n2CCCCOc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C30H36N2O2/c1-22-12-13-23(2)28(20-22)34-21-29-31-26-10-6-7-11-27(26)32(29)18-8-9-19-33-25-16-14-24(15-17-25)30(3,4)5/h6-7,10-17,20H,8-9,18-19,21H2,1-5H3 |
| InChIKey | ZQLRYZXXENSVQD-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|