C27H28Cl2N2O2 — CID 16997229
1-[3-(4-tert-butylphenoxy)propyl]-2-[(2,4-dichlorophenoxy)methyl]benzimidazole (PubChem CID 16997229) has the molecular formula C27H28Cl2N2O2 and a molecular weight of 483.44 g/mol. Its IUPAC name is 1-[3-(4-tert-butylphenoxy)propyl]-2-[(2,4-dichlorophenoxy)methyl]benzimidazole.
| Compound Name | 1-[3-(4-tert-butylphenoxy)propyl]-2-[(2,4-dichlorophenoxy)methyl]benzimidazole |
|---|---|
| PubChem CID | 16997229 |
| Molecular Formula | C27H28Cl2N2O2 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 1-[3-(4-tert-butylphenoxy)propyl]-2-[(2,4-dichlorophenoxy)methyl]benzimidazole |
| SMILES | CC(C)(C)c1ccc(OCCCn2c(COc3ccc(Cl)cc3Cl)nc3ccccc32)cc1 |
| InChI | InChI=1S/C27H28Cl2N2O2/c1-27(2,3)19-9-12-21(13-10-19)32-16-6-15-31-24-8-5-4-7-23(24)30-26(31)18-33-25-14-11-20(28)17-22(25)29/h4-5,7-14,17H,6,15-16,18H2,1-3H3 |
| InChIKey | PUZGUWZVYPEPRS-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|