C25H24Cl2N2O3 — CID 16997248
2-[(2,4-dichlorophenoxy)methyl]-1-[4-(4-methoxyphenoxy)butyl]benzimidazole (PubChem CID 16997248) has the molecular formula C25H24Cl2N2O3 and a molecular weight of 471.38 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenoxy)methyl]-1-[4-(4-methoxyphenoxy)butyl]benzimidazole.
| Compound Name | 2-[(2,4-dichlorophenoxy)methyl]-1-[4-(4-methoxyphenoxy)butyl]benzimidazole |
|---|---|
| PubChem CID | 16997248 |
| Molecular Formula | C25H24Cl2N2O3 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 2-[(2,4-dichlorophenoxy)methyl]-1-[4-(4-methoxyphenoxy)butyl]benzimidazole |
| SMILES | COc1ccc(OCCCCn2c(COc3ccc(Cl)cc3Cl)nc3ccccc32)cc1 |
| InChI | InChI=1S/C25H24Cl2N2O3/c1-30-19-9-11-20(12-10-19)31-15-5-4-14-29-23-7-3-2-6-22(23)28-25(29)17-32-24-13-8-18(26)16-21(24)27/h2-3,6-13,16H,4-5,14-15,17H2,1H3 |
| InChIKey | OGGFBJHYYWQIHO-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|