C27H29ClN2O3 — CID 16998558
1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]-2-[(4-methoxyphenoxy)methyl]benzimidazole (PubChem CID 16998558) has the molecular formula C27H29ClN2O3 and a molecular weight of 464.99 g/mol. Its IUPAC name is 1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]-2-[(4-methoxyphenoxy)methyl]benzimidazole.
| Compound Name | 1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]-2-[(4-methoxyphenoxy)methyl]benzimidazole |
|---|---|
| PubChem CID | 16998558 |
| Molecular Formula | C27H29ClN2O3 |
| Molecular Weight | 464.99 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]-2-[(4-methoxyphenoxy)methyl]benzimidazole |
| SMILES | COc1ccc(OCc2nc3ccccc3n2CCCCOc2cc(C)c(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C27H29ClN2O3/c1-19-16-23(17-20(2)27(19)28)32-15-7-6-14-30-25-9-5-4-8-24(25)29-26(30)18-33-22-12-10-21(31-3)11-13-22/h4-5,8-13,16-17H,6-7,14-15,18H2,1-3H3 |
| InChIKey | UZFMOMAJCFPZBX-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.99 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|