C25H25ClN2O2 — CID 16997111
2-[(4-chlorophenoxy)methyl]-1-[3-(3,5-dimethylphenoxy)propyl]benzimidazole (PubChem CID 16997111) has the molecular formula C25H25ClN2O2 and a molecular weight of 420.94 g/mol. Its IUPAC name is 2-[(4-chlorophenoxy)methyl]-1-[3-(3,5-dimethylphenoxy)propyl]benzimidazole.
| Compound Name | 2-[(4-chlorophenoxy)methyl]-1-[3-(3,5-dimethylphenoxy)propyl]benzimidazole |
|---|---|
| PubChem CID | 16997111 |
| Molecular Formula | C25H25ClN2O2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 2-[(4-chlorophenoxy)methyl]-1-[3-(3,5-dimethylphenoxy)propyl]benzimidazole |
| SMILES | Cc1cc(C)cc(OCCCn2c(COc3ccc(Cl)cc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C25H25ClN2O2/c1-18-14-19(2)16-22(15-18)29-13-5-12-28-24-7-4-3-6-23(24)27-25(28)17-30-21-10-8-20(26)9-11-21/h3-4,6-11,14-16H,5,12-13,17H2,1-2H3 |
| InChIKey | LLOCWVAFOONUGQ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|