C23H21ClN2O2 — CID 16997088
2-[(4-chlorophenoxy)methyl]-1-[2-(3-methylphenoxy)ethyl]benzimidazole (PubChem CID 16997088) has the molecular formula C23H21ClN2O2 and a molecular weight of 392.89 g/mol. Its IUPAC name is 2-[(4-chlorophenoxy)methyl]-1-[2-(3-methylphenoxy)ethyl]benzimidazole.
| Compound Name | 2-[(4-chlorophenoxy)methyl]-1-[2-(3-methylphenoxy)ethyl]benzimidazole |
|---|---|
| PubChem CID | 16997088 |
| Molecular Formula | C23H21ClN2O2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-[(4-chlorophenoxy)methyl]-1-[2-(3-methylphenoxy)ethyl]benzimidazole |
| SMILES | Cc1cccc(OCCn2c(COc3ccc(Cl)cc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C23H21ClN2O2/c1-17-5-4-6-20(15-17)27-14-13-26-22-8-3-2-7-21(22)25-23(26)16-28-19-11-9-18(24)10-12-19/h2-12,15H,13-14,16H2,1H3 |
| InChIKey | LMLAXNYZAKPLFY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |