C32H33ClN2O2 — CID 16996402
1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]-2-[1-(6-methoxynaphthalen-2-yl)ethyl]benzimidazole (PubChem CID 16996402) has the molecular formula C32H33ClN2O2 and a molecular weight of 513.08 g/mol. Its IUPAC name is 1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]-2-[1-(6-methoxynaphthalen-2-yl)ethyl]benzimidazole.
| Compound Name | 1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]-2-[1-(6-methoxynaphthalen-2-yl)ethyl]benzimidazole |
|---|---|
| PubChem CID | 16996402 |
| Molecular Formula | C32H33ClN2O2 |
| Molecular Weight | 513.08 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 1-[4-(4-chloro-3,5-dimethylphenoxy)butyl]-2-[1-(6-methoxynaphthalen-2-yl)ethyl]benzimidazole |
| SMILES | COc1ccc2cc(C(C)c3nc4ccccc4n3CCCCOc3cc(C)c(Cl)c(C)c3)ccc2c1 |
| InChI | InChI=1S/C32H33ClN2O2/c1-21-17-28(18-22(2)31(21)33)37-16-8-7-15-35-30-10-6-5-9-29(30)34-32(35)23(3)24-11-12-26-20-27(36-4)14-13-25(26)19-24/h5-6,9-14,17-20,23H,7-8,15-16H2,1-4H3 |
| InChIKey | GMDBUBCYEWIIGW-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.08 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|