C29H34N2O2 — CID 16996265
1-[3-(4-methoxyphenoxy)propyl]-2-[1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole (PubChem CID 16996265) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is 1-[3-(4-methoxyphenoxy)propyl]-2-[1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole.
| Compound Name | 1-[3-(4-methoxyphenoxy)propyl]-2-[1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole |
|---|---|
| PubChem CID | 16996265 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 1-[3-(4-methoxyphenoxy)propyl]-2-[1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole |
| SMILES | COc1ccc(OCCCn2c(C(C)c3ccc(CC(C)C)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C29H34N2O2/c1-21(2)20-23-10-12-24(13-11-23)22(3)29-30-27-8-5-6-9-28(27)31(29)18-7-19-33-26-16-14-25(32-4)15-17-26/h5-6,8-17,21-22H,7,18-20H2,1-4H3 |
| InChIKey | ZSDXTGZANYYLBU-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|