C26H36N2 — CID 94366017
1-heptyl-2-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole (PubChem CID 94366017) has the molecular formula C26H36N2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 1-heptyl-2-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole.
| Compound Name | 1-heptyl-2-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole |
|---|---|
| PubChem CID | 94366017 |
| Molecular Formula | C26H36N2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | 1-heptyl-2-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole |
| SMILES | CCCCCCCn1c([C@@H](C)c2ccc(CC(C)C)cc2)nc2ccccc21 |
| InChI | InChI=1S/C26H36N2/c1-5-6-7-8-11-18-28-25-13-10-9-12-24(25)27-26(28)21(4)23-16-14-22(15-17-23)19-20(2)3/h9-10,12-17,20-21H,5-8,11,18-19H2,1-4H3/t21-/m0/s1 |
| InChIKey | CIZWPMFFZWPRDR-NRFANRHFSA-N |
| XLogP | 7.36 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|