C25H34N2 — CID 7005495
1-hexyl-2-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole (PubChem CID 7005495) has the molecular formula C25H34N2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 1-hexyl-2-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole.
| Compound Name | 1-hexyl-2-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole |
|---|---|
| PubChem CID | 7005495 |
| Molecular Formula | C25H34N2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 1-hexyl-2-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole |
| SMILES | CCCCCCn1c([C@H](C)c2ccc(CC(C)C)cc2)nc2ccccc21 |
| InChI | InChI=1S/C25H34N2/c1-5-6-7-10-17-27-24-12-9-8-11-23(24)26-25(27)20(4)22-15-13-21(14-16-22)18-19(2)3/h8-9,11-16,19-20H,5-7,10,17-18H2,1-4H3/t20-/m1/s1 |
| InChIKey | NMFVXAHRUOOKJR-HXUWFJFHSA-N |
| XLogP | 6.97 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|