C23H30N2 — CID 7011097
1-butyl-2-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole (PubChem CID 7011097) has the molecular formula C23H30N2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 1-butyl-2-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole.
| Compound Name | 1-butyl-2-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole |
|---|---|
| PubChem CID | 7011097 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 1-butyl-2-[(1S)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole |
| SMILES | CCCCn1c([C@@H](C)c2ccc(CC(C)C)cc2)nc2ccccc21 |
| InChI | InChI=1S/C23H30N2/c1-5-6-15-25-22-10-8-7-9-21(22)24-23(25)18(4)20-13-11-19(12-14-20)16-17(2)3/h7-14,17-18H,5-6,15-16H2,1-4H3/t18-/m0/s1 |
| InChIKey | UQEJFCJEOYQHEN-SFHVURJKSA-N |
| XLogP | 6.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |