C27H30N2 — CID 7025660
1-[(3-methylphenyl)methyl]-2-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole (PubChem CID 7025660) has the molecular formula C27H30N2 and a molecular weight of 382.55 g/mol. Its IUPAC name is 1-[(3-methylphenyl)methyl]-2-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole.
| Compound Name | 1-[(3-methylphenyl)methyl]-2-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole |
|---|---|
| PubChem CID | 7025660 |
| Molecular Formula | C27H30N2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 1-[(3-methylphenyl)methyl]-2-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole |
| SMILES | Cc1cccc(Cn2c([C@H](C)c3ccc(CC(C)C)cc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C27H30N2/c1-19(2)16-22-12-14-24(15-13-22)21(4)27-28-25-10-5-6-11-26(25)29(27)18-23-9-7-8-20(3)17-23/h5-15,17,19,21H,16,18H2,1-4H3/t21-/m1/s1 |
| InChIKey | MZGGOCQFZDVILC-OAQYLSRUSA-N |
| XLogP | 6.74 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |