C28H40N2 — CID 94366022
2-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]-1-nonylbenzimidazole (PubChem CID 94366022) has the molecular formula C28H40N2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 2-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]-1-nonylbenzimidazole.
| Compound Name | 2-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]-1-nonylbenzimidazole |
|---|---|
| PubChem CID | 94366022 |
| Molecular Formula | C28H40N2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | 2-[(1R)-1-[4-(2-methylpropyl)phenyl]ethyl]-1-nonylbenzimidazole |
| SMILES | CCCCCCCCCn1c([C@H](C)c2ccc(CC(C)C)cc2)nc2ccccc21 |
| InChI | InChI=1S/C28H40N2/c1-5-6-7-8-9-10-13-20-30-27-15-12-11-14-26(27)29-28(30)23(4)25-18-16-24(17-19-25)21-22(2)3/h11-12,14-19,22-23H,5-10,13,20-21H2,1-4H3/t23-/m1/s1 |
| InChIKey | VWCIIFHNIITXDH-HSZRJFAPSA-N |
| XLogP | 8.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|