C30H36N2O — CID 18879423
1-[4-(4-methylphenoxy)butyl]-2-[1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole (PubChem CID 18879423) has the molecular formula C30H36N2O and a molecular weight of 440.63 g/mol. Its IUPAC name is 1-[4-(4-methylphenoxy)butyl]-2-[1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole.
| Compound Name | 1-[4-(4-methylphenoxy)butyl]-2-[1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole |
|---|---|
| PubChem CID | 18879423 |
| Molecular Formula | C30H36N2O |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | 1-[4-(4-methylphenoxy)butyl]-2-[1-[4-(2-methylpropyl)phenyl]ethyl]benzimidazole |
| SMILES | Cc1ccc(OCCCCn2c(C(C)c3ccc(CC(C)C)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C30H36N2O/c1-22(2)21-25-13-15-26(16-14-25)24(4)30-31-28-9-5-6-10-29(28)32(30)19-7-8-20-33-27-17-11-23(3)12-18-27/h5-6,9-18,22,24H,7-8,19-21H2,1-4H3 |
| InChIKey | UIZJCZCZRDRGQB-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|