C25H24Cl2N2O2 — CID 16997226
2-[(2,4-dichlorophenoxy)methyl]-1-[3-(3,4-dimethylphenoxy)propyl]benzimidazole (PubChem CID 16997226) has the molecular formula C25H24Cl2N2O2 and a molecular weight of 455.39 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenoxy)methyl]-1-[3-(3,4-dimethylphenoxy)propyl]benzimidazole.
| Compound Name | 2-[(2,4-dichlorophenoxy)methyl]-1-[3-(3,4-dimethylphenoxy)propyl]benzimidazole |
|---|---|
| PubChem CID | 16997226 |
| Molecular Formula | C25H24Cl2N2O2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-[(2,4-dichlorophenoxy)methyl]-1-[3-(3,4-dimethylphenoxy)propyl]benzimidazole |
| SMILES | Cc1ccc(OCCCn2c(COc3ccc(Cl)cc3Cl)nc3ccccc32)cc1C |
| InChI | InChI=1S/C25H24Cl2N2O2/c1-17-8-10-20(14-18(17)2)30-13-5-12-29-23-7-4-3-6-22(23)28-25(29)16-31-24-11-9-19(26)15-21(24)27/h3-4,6-11,14-15H,5,12-13,16H2,1-2H3 |
| InChIKey | RHSSIAFTSFWUQT-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|