C28H28N4O2 — CID 16986199
(Z)-N-[3-[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]-3-phenylprop-2-enamide (PubChem CID 16986199) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is (Z)-N-[3-[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[3-[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16986199 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | (Z)-N-[3-[1-[2-(N-methylanilino)-2-oxoethyl]benzimidazol-2-yl]propyl]-3-phenylprop-2-enamide |
| SMILES | CN(C(=O)Cn1c(CCCNC(=O)/C=C\c2ccccc2)nc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C28H28N4O2/c1-31(23-13-6-3-7-14-23)28(34)21-32-25-16-9-8-15-24(25)30-26(32)17-10-20-29-27(33)19-18-22-11-4-2-5-12-22/h2-9,11-16,18-19H,10,17,20-21H2,1H3,(H,29,33)/b19-18- |
| InChIKey | MKDZGIWCLDFBRT-HNENSFHCSA-N |
| XLogP | 4.46 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|