C32H38N4O5 — CID 16984078
N-[3-[1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide (PubChem CID 16984078) has the molecular formula C32H38N4O5 and a molecular weight of 558.68 g/mol. Its IUPAC name is N-[3-[1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-[1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 16984078 |
| Molecular Formula | C32H38N4O5 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.28 |
| IUPAC Name | N-[3-[1-[2-[benzyl(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCCc2nc3ccccc3n2CC(=O)N(Cc2ccccc2)C(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C32H38N4O5/c1-22(2)35(20-23-12-7-6-8-13-23)30(37)21-36-26-15-10-9-14-25(26)34-29(36)16-11-17-33-32(38)24-18-27(39-3)31(41-5)28(19-24)40-4/h6-10,12-15,18-19,22H,11,16-17,20-21H2,1-5H3,(H,33,38) |
| InChIKey | FHWUJLSEAHBNDD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|