C27H36N4O4 — CID 16983903
N-[3-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-3,4-dimethoxybenzamide (PubChem CID 16983903) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-[3-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[3-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 16983903 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | N-[3-[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]propyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCc2nc3ccccc3n2CC(=O)N(C(C)C)C(C)C)cc1OC |
| InChI | InChI=1S/C27H36N4O4/c1-18(2)31(19(3)4)26(32)17-30-22-11-8-7-10-21(22)29-25(30)12-9-15-28-27(33)20-13-14-23(34-5)24(16-20)35-6/h7-8,10-11,13-14,16,18-19H,9,12,15,17H2,1-6H3,(H,28,33) |
| InChIKey | DGZFIMQLSANEPN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|