C25H30N4O2 — CID 16970879
(Z)-N-[[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 16970879) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is (Z)-N-[[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]methyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 16970879 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (Z)-N-[[1-[2-[di(propan-2-yl)amino]-2-oxoethyl]benzimidazol-2-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | CC(C)N(C(=O)Cn1c(CNC(=O)/C=C\c2ccccc2)nc2ccccc21)C(C)C |
| InChI | InChI=1S/C25H30N4O2/c1-18(2)29(19(3)4)25(31)17-28-22-13-9-8-12-21(22)27-23(28)16-26-24(30)15-14-20-10-6-5-7-11-20/h5-15,18-19H,16-17H2,1-4H3,(H,26,30)/b15-14- |
| InChIKey | CAGKPOCTAZXQRD-PFONDFGASA-N |
| XLogP | 4.01 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|