C29H40N4O2 — CID 16989724
N-[5-[1-[2-(dipropylamino)-2-oxoethyl]benzimidazol-2-yl]pentyl]-2,4-dimethylbenzamide (PubChem CID 16989724) has the molecular formula C29H40N4O2 and a molecular weight of 476.67 g/mol. Its IUPAC name is N-[5-[1-[2-(dipropylamino)-2-oxoethyl]benzimidazol-2-yl]pentyl]-2,4-dimethylbenzamide.
| Compound Name | N-[5-[1-[2-(dipropylamino)-2-oxoethyl]benzimidazol-2-yl]pentyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 16989724 |
| Molecular Formula | C29H40N4O2 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.32 |
| IUPAC Name | N-[5-[1-[2-(dipropylamino)-2-oxoethyl]benzimidazol-2-yl]pentyl]-2,4-dimethylbenzamide |
| SMILES | CCCN(CCC)C(=O)Cn1c(CCCCCNC(=O)c2ccc(C)cc2C)nc2ccccc21 |
| InChI | InChI=1S/C29H40N4O2/c1-5-18-32(19-6-2)28(34)21-33-26-13-10-9-12-25(26)31-27(33)14-8-7-11-17-30-29(35)24-16-15-22(3)20-23(24)4/h9-10,12-13,15-16,20H,5-8,11,14,17-19,21H2,1-4H3,(H,30,35) |
| InChIKey | JBAHVOFTNABBAN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|