C23H27N3O — CID 16982506
2,4-dimethyl-N-[3-[1-(2-methylprop-2-enyl)benzimidazol-2-yl]propyl]benzamide (PubChem CID 16982506) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 2,4-dimethyl-N-[3-[1-(2-methylprop-2-enyl)benzimidazol-2-yl]propyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[3-[1-(2-methylprop-2-enyl)benzimidazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 16982506 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 2,4-dimethyl-N-[3-[1-(2-methylprop-2-enyl)benzimidazol-2-yl]propyl]benzamide |
| SMILES | C=C(C)Cn1c(CCCNC(=O)c2ccc(C)cc2C)nc2ccccc21 |
| InChI | InChI=1S/C23H27N3O/c1-16(2)15-26-21-9-6-5-8-20(21)25-22(26)10-7-13-24-23(27)19-12-11-17(3)14-18(19)4/h5-6,8-9,11-12,14H,1,7,10,13,15H2,2-4H3,(H,24,27) |
| InChIKey | LJRQRJLZTQNENG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|