C24H31N3O — CID 16982511
2,4-dimethyl-N-[3-[1-(2-methylbutyl)benzimidazol-2-yl]propyl]benzamide (PubChem CID 16982511) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 2,4-dimethyl-N-[3-[1-(2-methylbutyl)benzimidazol-2-yl]propyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[3-[1-(2-methylbutyl)benzimidazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 16982511 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 2,4-dimethyl-N-[3-[1-(2-methylbutyl)benzimidazol-2-yl]propyl]benzamide |
| SMILES | CCC(C)Cn1c(CCCNC(=O)c2ccc(C)cc2C)nc2ccccc21 |
| InChI | InChI=1S/C24H31N3O/c1-5-17(2)16-27-22-10-7-6-9-21(22)26-23(27)11-8-14-25-24(28)20-13-12-18(3)15-19(20)4/h6-7,9-10,12-13,15,17H,5,8,11,14,16H2,1-4H3,(H,25,28) |
| InChIKey | JVTPDIRJHVAFIA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|