C26H26BrN3O — CID 16984734
4-bromo-N-[3-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]propyl]benzamide (PubChem CID 16984734) has the molecular formula C26H26BrN3O and a molecular weight of 476.42 g/mol. Its IUPAC name is 4-bromo-N-[3-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]propyl]benzamide.
| Compound Name | 4-bromo-N-[3-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]propyl]benzamide |
|---|---|
| PubChem CID | 16984734 |
| Molecular Formula | C26H26BrN3O |
| Molecular Weight | 476.42 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 4-bromo-N-[3-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]propyl]benzamide |
| SMILES | Cc1ccc(C)c(Cn2c(CCCNC(=O)c3ccc(Br)cc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C26H26BrN3O/c1-18-9-10-19(2)21(16-18)17-30-24-7-4-3-6-23(24)29-25(30)8-5-15-28-26(31)20-11-13-22(27)14-12-20/h3-4,6-7,9-14,16H,5,8,15,17H2,1-2H3,(H,28,31) |
| InChIKey | RNOODCIYUXLRNV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.42 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|