C25H26N4O — CID 16966196
N-[3-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]propyl]pyridine-2-carboxamide (PubChem CID 16966196) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is N-[3-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]propyl]pyridine-2-carboxamide.
| Compound Name | N-[3-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 16966196 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | N-[3-[1-[(2,5-dimethylphenyl)methyl]benzimidazol-2-yl]propyl]pyridine-2-carboxamide |
| SMILES | Cc1ccc(C)c(Cn2c(CCCNC(=O)c3ccccn3)nc3ccccc32)c1 |
| InChI | InChI=1S/C25H26N4O/c1-18-12-13-19(2)20(16-18)17-29-23-10-4-3-8-21(23)28-24(29)11-7-15-27-25(30)22-9-5-6-14-26-22/h3-6,8-10,12-14,16H,7,11,15,17H2,1-2H3,(H,27,30) |
| InChIKey | HRAHRXWOTUKCFG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|