C26H28N4O2 — CID 16966276
N-[3-[1-[2-(3,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]propyl]pyridine-2-carboxamide (PubChem CID 16966276) has the molecular formula C26H28N4O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[3-[1-[2-(3,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]propyl]pyridine-2-carboxamide.
| Compound Name | N-[3-[1-[2-(3,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]propyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 16966276 |
| Molecular Formula | C26H28N4O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | N-[3-[1-[2-(3,4-dimethylphenoxy)ethyl]benzimidazol-2-yl]propyl]pyridine-2-carboxamide |
| SMILES | Cc1ccc(OCCn2c(CCCNC(=O)c3ccccn3)nc3ccccc32)cc1C |
| InChI | InChI=1S/C26H28N4O2/c1-19-12-13-21(18-20(19)2)32-17-16-30-24-10-4-3-8-22(24)29-25(30)11-7-15-28-26(31)23-9-5-6-14-27-23/h3-6,8-10,12-14,18H,7,11,15-17H2,1-2H3,(H,28,31) |
| InChIKey | KPUPYSREBWMLPD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|