C25H25ClN4O2 — CID 16966076
N-[3-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]propyl]pyridine-4-carboxamide (PubChem CID 16966076) has the molecular formula C25H25ClN4O2 and a molecular weight of 448.95 g/mol. Its IUPAC name is N-[3-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]propyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]propyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 16966076 |
| Molecular Formula | C25H25ClN4O2 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | N-[3-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]propyl]pyridine-4-carboxamide |
| SMILES | Cc1cc(OCCn2c(CCCNC(=O)c3ccncc3)nc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C25H25ClN4O2/c1-18-17-20(8-9-21(18)26)32-16-15-30-23-6-3-2-5-22(23)29-24(30)7-4-12-28-25(31)19-10-13-27-14-11-19/h2-3,5-6,8-11,13-14,17H,4,7,12,15-16H2,1H3,(H,28,31) |
| InChIKey | WSQQXPOGGLIRJL-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|