C25H23BrClN3O2 — CID 16977495
4-bromo-N-[2-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide (PubChem CID 16977495) has the molecular formula C25H23BrClN3O2 and a molecular weight of 512.84 g/mol. Its IUPAC name is 4-bromo-N-[2-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 16977495 |
| Molecular Formula | C25H23BrClN3O2 |
| Molecular Weight | 512.84 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 4-bromo-N-[2-[1-[2-(4-chloro-3-methylphenoxy)ethyl]benzimidazol-2-yl]ethyl]benzamide |
| SMILES | Cc1cc(OCCn2c(CCNC(=O)c3ccc(Br)cc3)nc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C25H23BrClN3O2/c1-17-16-20(10-11-21(17)27)32-15-14-30-23-5-3-2-4-22(23)29-24(30)12-13-28-25(31)18-6-8-19(26)9-7-18/h2-11,16H,12-15H2,1H3,(H,28,31) |
| InChIKey | VCPVOYTWORRNAU-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.84 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |